2-Amino-3-methyl-N-phenylbenzamide, 95%
cas: 926260-18-6 — see every product listed under this CAS number, including other names
2-Amino-3-methyl-N-phenylbenzamide, 95% (CAS 926260-18-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1598332-250mg |
| cas | 926260-18-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 709.69 Pln | |
| Ambeed | 1g | 1727.62 Pln | |
| BLDpharm | 100mg | 442.09 Pln | |
| BLDpharm | 250mg | 697.56 Pln | |
| BLDpharm | 1g | 1691.65 Pln | |
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 606.80 Pln | |
| Chemat | 1g | 1528.40 Pln | |
| Fluorochem | 100mg | 695.61 Pln | |
| Fluorochem | 250mg | 1117.33 Pln | |
| Fluorochem | 1g | 2851.10 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-amino-3-methyl-N-phenylbenzamide (CAS 926260-18-6) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: 2-amino-3-methyl-N-phenylbenzamide. InChIKey: HNAVBAYYCHVVLR-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2-amino-3-methyl-N-phenylbenzamide |
| InChIKey | HNAVBAYYCHVVLR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)NC2=CC=CC=C2)N |
Computed by PubChem (NCBI)