CAS 2150-58-5 appears in our catalog under these names: Phenol blue, 95%, N,N-DIMETHYLINDOANILINE. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 250mg, 5g, 1g.
4-[4-(dimethylamino)phenyl]iminocyclohexa-2,5-dien-1-one (CAS 2150-58-5) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: 4-[4-(dimethylamino)phenyl]iminocyclohexa-2,5-dien-1-one. InChIKey: LHGMHYDJNXEEFG-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 4-[4-(dimethylamino)phenyl]iminocyclohexa-2,5-dien-1-one |
| InChIKey | LHGMHYDJNXEEFG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=C2C=CC(=O)C=C2 |
Computed by PubChem (NCBI)