CAS 955-98-6 appears in our catalog under these names: 4,4'-Azoxytoluene, 95%, 4,4'-Dimethylazoxybenzene, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg.
(4-methylphenyl)-(4-methylphenyl)imino-oxidoazanium (CAS 955-98-6) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: (4-methylphenyl)-(4-methylphenyl)imino-oxidoazanium. InChIKey: SDCOJRCIBWCATN-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | (4-methylphenyl)-(4-methylphenyl)imino-oxidoazanium |
| InChIKey | SDCOJRCIBWCATN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N=[N+](C2=CC=C(C=C2)C)[O-] |
Computed by PubChem (NCBI)