cas: 102580-07-4 — see every product listed under this CAS number, including other names
2-Amino-4-(benzyloxy)phenol, 95%, 95% (CAS 102580-07-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H0TI-5mg |
| cas | 102580-07-4 |
| size | 5mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 122.00 Pln | |
| Chemat | 25mg | 304.40 Pln | |
| Chemat | 50mg | 544.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-4-phenylmethoxyphenol (CAS 102580-07-4) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 2-amino-4-phenylmethoxyphenol. InChIKey: STOOCDNLVDBYAP-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2-amino-4-phenylmethoxyphenol |
| InChIKey | STOOCDNLVDBYAP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)O)N |
Computed by PubChem (NCBI)