CAS 92513-34-3 is the registry number for 2,7,8-Trimethylquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,7,8-trimethylquinoline-3-carboxylic acid (CAS 92513-34-3) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 2,7,8-trimethylquinoline-3-carboxylic acid. InChIKey: KNGACCJHYQQKRJ-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2,7,8-trimethylquinoline-3-carboxylic acid |
| InChIKey | KNGACCJHYQQKRJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC(=C(C=C2C=C1)C(=O)O)C)C |
Computed by PubChem (NCBI)