Products 92513-34-3

CAS 92513-34-3 is the registry number for 2,7,8-Trimethylquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2,7,8-trimethylquinoline-3-carboxylic acid (CAS 92513-34-3) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 2,7,8-trimethylquinoline-3-carboxylic acid. InChIKey: KNGACCJHYQQKRJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO2
Molecular weight215.25 g/mol
IUPAC name2,7,8-trimethylquinoline-3-carboxylic acid
InChIKeyKNGACCJHYQQKRJ-UHFFFAOYSA-N
SMILESCC1=C(C2=NC(=C(C=C2C=C1)C(=O)O)C)C

Computed by PubChem (NCBI)