Products 26088-66-4
CAS 26088-66-4 appears in our catalog under these names: 2,3,4,9-Tetrahydro-1H-carbazole-3-carboxylic acid, 97%, 2，3，4，9–Tetrahydro–1H–carbazole–3–carboxylic acid, 2,3,4,9-Tetrahydro-1H-carbazole-3-carboxylic acid 98%, 2,3,4,9-Tetrahydro-1H-carbazole-3-carboxylic acid, 98%, 98%, 2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.
2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid (CAS 26088-66-4) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid. InChIKey: CGJLAUQMHSAAMY-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid |
| InChIKey | CGJLAUQMHSAAMY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1C(=O)O)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)