cas: 1260847-67-3 — see every product listed under this CAS number, including other names
2-Amino-4-(trifluoromethoxy)benzonitrile 95% (CAS 1260847-67-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A687989-250mg |
| cas | 1260847-67-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1171.38 Pln | |
| Ambeed | 5g | 3591.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A687989 |
2-amino-4-(trifluoromethoxy)benzonitrile (CAS 1260847-67-3) is a chemical compound with the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. IUPAC name: 2-amino-4-(trifluoromethoxy)benzonitrile. InChIKey: AHMPXTDNCULSNA-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 2-amino-4-(trifluoromethoxy)benzonitrile |
| InChIKey | AHMPXTDNCULSNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)N)C#N |
Computed by PubChem (NCBI)