CAS 175277-89-1 is the registry number for 2-(2,2,2-Trifluoroethoxy)nicotinonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
2-(2,2,2-trifluoroethoxy)pyridine-3-carbonitrile (CAS 175277-89-1) is a chemical compound with the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. IUPAC name: 2-(2,2,2-trifluoroethoxy)pyridine-3-carbonitrile. InChIKey: ZTQQMHFXDKEKHR-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethoxy)pyridine-3-carbonitrile |
| InChIKey | ZTQQMHFXDKEKHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OCC(F)(F)F)C#N |
Computed by PubChem (NCBI)