CAS 887707-29-1 appears in our catalog under these names: 2-Methoxy-3-(trifluoromethyl)-5-cyanopyridine, 95%, 6-Methoxy-5-(trifluoromethyl)nicotinonitrile, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
6-methoxy-5-(trifluoromethyl)pyridine-3-carbonitrile (CAS 887707-29-1) is a chemical compound with the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. IUPAC name: 6-methoxy-5-(trifluoromethyl)pyridine-3-carbonitrile. InChIKey: LMODEHOSNLUKSK-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 6-methoxy-5-(trifluoromethyl)pyridine-3-carbonitrile |
| InChIKey | LMODEHOSNLUKSK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)C#N)C(F)(F)F |
Computed by PubChem (NCBI)