cas: 20358-02-5 — see every product listed under this CAS number, including other names
2-Amino-4-bromobenzothiazole, 98% (CAS 20358-02-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033433-5G |
| cas | 20358-02-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 279.09 Pln | |
| Fluorochem | 10g | 482.14 Pln | |
| Fluorochem | 25g | 981.96 Pln | |
| Fluorochem | 100g | 3715.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-bromo-1,3-benzothiazol-2-amine (CAS 20358-02-5) is a chemical compound with the molecular formula C7H5BrN2S and a molecular weight of 229.10 g/mol. IUPAC name: 4-bromo-1,3-benzothiazol-2-amine. InChIKey: FVMCARDEQKVVIS-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2S |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 4-bromo-1,3-benzothiazol-2-amine |
| InChIKey | FVMCARDEQKVVIS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C(S2)N |
Computed by PubChem (NCBI)