cas: 20358-02-5 — see every product listed under this CAS number, including other names
2-Benzothiazolamine, 4-bromo-, 98%, 98% (CAS 20358-02-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11301I-250mg |
| cas | 20358-02-5 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 10g | 342.80 Pln | |
| Chemat | 25g | 731.60 Pln | |
| Chemat | 100g | 2714.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-1,3-benzothiazol-2-amine (CAS 20358-02-5) is a chemical compound with the molecular formula C7H5BrN2S and a molecular weight of 229.10 g/mol. IUPAC name: 4-bromo-1,3-benzothiazol-2-amine. InChIKey: FVMCARDEQKVVIS-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2S |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 4-bromo-1,3-benzothiazol-2-amine |
| InChIKey | FVMCARDEQKVVIS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C(S2)N |
Computed by PubChem (NCBI)