cas: 20358-02-5 — see every product listed under this CAS number, including other names
4-Bromobenzo[d]thiazol-2-amine 98% (CAS 20358-02-5) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A143586-500g |
| cas | 20358-02-5 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 15383.56 Pln | |
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 10g | 498.31 Pln | |
| Ambeed | 25g | 1026.75 Pln | |
| Ambeed | 100g | 3897.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A143586 |
4-bromo-1,3-benzothiazol-2-amine (CAS 20358-02-5) is a chemical compound with the molecular formula C7H5BrN2S and a molecular weight of 229.10 g/mol. IUPAC name: 4-bromo-1,3-benzothiazol-2-amine. InChIKey: FVMCARDEQKVVIS-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2S |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 4-bromo-1,3-benzothiazol-2-amine |
| InChIKey | FVMCARDEQKVVIS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C(S2)N |
Computed by PubChem (NCBI)