cas: 6980-08-1 — see every product listed under this CAS number, including other names
2-Amino-4-chloro-3-nitropyridine, 98% (CAS 6980-08-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F038299-1G |
| cas | 6980-08-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 10g | 351.98 Pln | |
| Fluorochem | 25g | 758.08 Pln | |
| Fluorochem | 100g | 2788.62 Pln | |
| Fluorochem | 500g | 13717.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-3-nitropyridin-2-amine (CAS 6980-08-1) is a chemical compound with the molecular formula C5H4ClN3O2 and a molecular weight of 173.56 g/mol. IUPAC name: 4-chloro-3-nitropyridin-2-amine. InChIKey: DIRINUVNYFAWQF-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN3O2 |
|---|---|
| Molecular weight | 173.56 g/mol |
| IUPAC name | 4-chloro-3-nitropyridin-2-amine |
| InChIKey | DIRINUVNYFAWQF-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)[N+](=O)[O-])N |
Computed by PubChem (NCBI)