cas: 6980-08-1 — see every product listed under this CAS number, including other names
4-Chloro-3-nitropyridin-2-amine, 98%, 98% (CAS 6980-08-1) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FCE2-1kg |
| cas | 6980-08-1 |
| size | 1kg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 10509.20 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 434.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-3-nitropyridin-2-amine (CAS 6980-08-1) is a chemical compound with the molecular formula C5H4ClN3O2 and a molecular weight of 173.56 g/mol. IUPAC name: 4-chloro-3-nitropyridin-2-amine. InChIKey: DIRINUVNYFAWQF-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN3O2 |
|---|---|
| Molecular weight | 173.56 g/mol |
| IUPAC name | 4-chloro-3-nitropyridin-2-amine |
| InChIKey | DIRINUVNYFAWQF-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)[N+](=O)[O-])N |
Computed by PubChem (NCBI)