cas: 6358-07-2 — see every product listed under this CAS number, including other names
2-Amino-4-chloro-5-nitrophenol (CAS 6358-07-2) is a chemical reagent available from Chemat. Available pack sizes: 250g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224050-250G |
| cas | 6358-07-2 |
| size | 250g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250g | 1153.78 Pln | |
| Fluorochem | 25g | 221.81 Pln |
| delivery time | 3-4 weeks |
|---|
2-amino-4-chloro-5-nitrophenol (CAS 6358-07-2) is a chemical compound with the molecular formula C6H5ClN2O3 and a molecular weight of 188.57 g/mol. IUPAC name: 2-amino-4-chloro-5-nitrophenol. InChIKey: ZARYBZGMUVAJMK-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O3 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 2-amino-4-chloro-5-nitrophenol |
| InChIKey | ZARYBZGMUVAJMK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)[N+](=O)[O-])O)N |
Computed by PubChem (NCBI)