CAS 60323-96-8 appears in our catalog under these names: 2-Chloro-5-methyl-4-nitropyridine N-oxide, 98%, 2–Chloro–5–Methyl–4–Nitro–Pyridine 1–Oxide, 2-Chloro-5-methyl-4-nitropyridine N-oxide, 97%, 97%, 2-Chloro-5-methyl-4-nitropyridine N-oxide, 95%, 2-Chloro-5-methyl-4-nitropyridine 1-oxide, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 100g, 5g, 25g, 1g.
2-chloro-5-methyl-4-nitro-1-oxidopyridin-1-ium (CAS 60323-96-8) is a chemical compound with the molecular formula C6H5ClN2O3 and a molecular weight of 188.57 g/mol. IUPAC name: 2-chloro-5-methyl-4-nitro-1-oxidopyridin-1-ium. InChIKey: DXJQKWNJVPTPSK-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O3 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 2-chloro-5-methyl-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | DXJQKWNJVPTPSK-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=C(C=C1[N+](=O)[O-])Cl)[O-] |
Computed by PubChem (NCBI)