CAS 1803582-88-8 is the registry number for 3-Nitroisonicotinaldehyde hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-nitropyridine-4-carbaldehyde;hydrochloride (CAS 1803582-88-8) is a chemical compound with the molecular formula C6H5ClN2O3 and a molecular weight of 188.57 g/mol. IUPAC name: 3-nitropyridine-4-carbaldehyde;hydrochloride. InChIKey: MEPBNVQKERBNLR-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O3 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 3-nitropyridine-4-carbaldehyde;hydrochloride |
| InChIKey | MEPBNVQKERBNLR-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C=O)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)