cas: 6358-08-3 — see every product listed under this CAS number, including other names
2-Amino-4-chloro-6-nitrophenol (CAS 6358-08-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221564-250MG |
| cas | 6358-08-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 25g | 596.68 Pln | |
| Fluorochem | 100g | 1434.93 Pln |
| delivery time | 2-3 weeks |
|---|
2-amino-4-chloro-6-nitrophenol (CAS 6358-08-3) is a chemical compound with the molecular formula C6H5ClN2O3 and a molecular weight of 188.57 g/mol. IUPAC name: 2-amino-4-chloro-6-nitrophenol. InChIKey: MHAFRUMLQZZSIN-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O3 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 2-amino-4-chloro-6-nitrophenol |
| InChIKey | MHAFRUMLQZZSIN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)