cas: 4487-50-7 — see every product listed under this CAS number, including other names
2-Amino-4-nitropyridine, 97%, 97% (CAS 4487-50-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11455L-100mg |
| cas | 4487-50-7 |
| size | 100mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 717.20 Pln | |
| Chemat | 10g | 1317.20 Pln | |
| Chemat | 25g | 3064.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-nitropyridin-2-amine (CAS 4487-50-7) is a chemical compound with the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. IUPAC name: 4-nitropyridin-2-amine. InChIKey: DBDHHHBAZZYVJG-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O2 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 4-nitropyridin-2-amine |
| InChIKey | DBDHHHBAZZYVJG-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)