CAS 14916-64-4 appears in our catalog under these names: 2-Nitropyridin-4-amine, 4-Amino-2-nitropyridine, 95%, 2-Nitropyridin-4-amine 97%, 4-Amino-2-nitropyridine, 97%, 97%. Offered by: TRC, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg.
2-nitropyridin-4-amine (CAS 14916-64-4) is a chemical compound with the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. IUPAC name: 2-nitropyridin-4-amine. InChIKey: ZPFUWAVLEWIOEJ-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O2 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 2-nitropyridin-4-amine |
| InChIKey | ZPFUWAVLEWIOEJ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1N)[N+](=O)[O-] |
Computed by PubChem (NCBI)