Products 13505-02-7
CAS 13505-02-7 appears in our catalog under these names: 3-Amino-4-nitropyridine, 95%, 4-Nitropyridin-3-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-nitropyridin-3-amine (CAS 13505-02-7) is a chemical compound with the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. IUPAC name: 4-nitropyridin-3-amine. InChIKey: SXIUYRNIWXQXEA-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O2 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 4-nitropyridin-3-amine |
| InChIKey | SXIUYRNIWXQXEA-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)