cas: 549488-77-9 — see every product listed under this CAS number, including other names
2-Amino-5-(trifluoromethoxy)benzonitrile, 98%, 98% (CAS 549488-77-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DBQ0-100mg |
| cas | 549488-77-9 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 352.40 Pln | |
| Chemat | 10g | 630.80 Pln | |
| Chemat | 25g | 1211.60 Pln | |
| Chemat | 100g | 4590.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-5-(trifluoromethoxy)benzonitrile (CAS 549488-77-9) is a chemical compound with the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. IUPAC name: 2-amino-5-(trifluoromethoxy)benzonitrile. InChIKey: IEAPDKSDIISMDE-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 2-amino-5-(trifluoromethoxy)benzonitrile |
| InChIKey | IEAPDKSDIISMDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)C#N)N |
Computed by PubChem (NCBI)