cas: 3073-77-6 — see every product listed under this CAS number, including other names
2-Amino-5-nitropyrimidine, 95% (CAS 3073-77-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076887-1G |
| cas | 3073-77-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 221.81 Pln | |
| Fluorochem | 25g | 419.66 Pln | |
| Fluorochem | 100g | 1388.07 Pln | |
| Fluorochem | 500g | 6688.29 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-nitropyrimidin-2-amine (CAS 3073-77-6) is a chemical compound with the molecular formula C4H4N4O2 and a molecular weight of 140.10 g/mol. IUPAC name: 5-nitropyrimidin-2-amine. InChIKey: SSHFCFRJYJIJDV-UHFFFAOYSA-N.
| Molecular formula | C4H4N4O2 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 5-nitropyrimidin-2-amine |
| InChIKey | SSHFCFRJYJIJDV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)