cas: 3073-77-6 — see every product listed under this CAS number, including other names
2-Pyrimidinamine, 5-nitro-, 97%, 97% (CAS 3073-77-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11423F-1g |
| cas | 3073-77-6 |
| size | 1g |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 25g | 328.40 Pln | |
| Chemat | 100g | 1101.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-nitropyrimidin-2-amine (CAS 3073-77-6) is a chemical compound with the molecular formula C4H4N4O2 and a molecular weight of 140.10 g/mol. IUPAC name: 5-nitropyrimidin-2-amine. InChIKey: SSHFCFRJYJIJDV-UHFFFAOYSA-N.
| Molecular formula | C4H4N4O2 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 5-nitropyrimidin-2-amine |
| InChIKey | SSHFCFRJYJIJDV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)