cas: 918667-28-4 — see every product listed under this CAS number, including other names
2-Amino-6-(trifluoromethyl)benzoic acid hydrochloride, 97%, 97% (CAS 918667-28-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGX8-250mg |
| cas | 918667-28-4 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 750.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-6-(trifluoromethyl)benzoic acid;hydrochloride (CAS 918667-28-4) is a chemical compound with the molecular formula C8H7ClF3NO2 and a molecular weight of 241.59 g/mol. IUPAC name: 2-amino-6-(trifluoromethyl)benzoic acid;hydrochloride. InChIKey: YGSNRIVWQPNEIT-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO2 |
|---|---|
| Molecular weight | 241.59 g/mol |
| IUPAC name | 2-amino-6-(trifluoromethyl)benzoic acid;hydrochloride |
| InChIKey | YGSNRIVWQPNEIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)C(=O)O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)