CAS 1280786-68-6 is the registry number for 5-Chloro-2-methoxy-3-(2,2,2-trifluoroethoxy)pyridine, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
5-chloro-2-methoxy-3-(2,2,2-trifluoroethoxy)pyridine (CAS 1280786-68-6) is a chemical compound with the molecular formula C8H7ClF3NO2 and a molecular weight of 241.59 g/mol. IUPAC name: 5-chloro-2-methoxy-3-(2,2,2-trifluoroethoxy)pyridine. InChIKey: ZFEUGKLODVCOCF-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO2 |
|---|---|
| Molecular weight | 241.59 g/mol |
| IUPAC name | 5-chloro-2-methoxy-3-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | ZFEUGKLODVCOCF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)Cl)OCC(F)(F)F |
Computed by PubChem (NCBI)