CAS 918667-28-4 appears in our catalog under these names: 2-Amino-6-(trifluoromethyl)benzoic acid hydrochloride, 95%, 2–Amino–6–(trifluoromethyl)benzoic acid hydrochloride, 2-Amino-6-(trifluoromethyl)benzoic acid hydrochloride 97%, 2-Amino-6-(trifluoromethyl)benzoic acid hydrochloride, 97%, 97%, 2-Amino-6-(trifluoromethyl)benzoic acid hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 100g, 1g, 250mg.
2-amino-6-(trifluoromethyl)benzoic acid;hydrochloride (CAS 918667-28-4) is a chemical compound with the molecular formula C8H7ClF3NO2 and a molecular weight of 241.59 g/mol. IUPAC name: 2-amino-6-(trifluoromethyl)benzoic acid;hydrochloride. InChIKey: YGSNRIVWQPNEIT-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO2 |
|---|---|
| Molecular weight | 241.59 g/mol |
| IUPAC name | 2-amino-6-(trifluoromethyl)benzoic acid;hydrochloride |
| InChIKey | YGSNRIVWQPNEIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)C(=O)O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)