cas: 137110-42-0 — see every product listed under this CAS number, including other names
2-Amino-6-chloro-3-methylquinoline, ≥95%, ≥95% (CAS 137110-42-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1123V5-250mg |
| cas | 137110-42-0 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 678.80 Pln | |
| Chemat | 1g | 1672.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
6-chloro-3-methylquinolin-2-amine (CAS 137110-42-0) is a chemical compound with the molecular formula C10H9ClN2 and a molecular weight of 192.64 g/mol. IUPAC name: 6-chloro-3-methylquinolin-2-amine. InChIKey: VHUGVEXJEVUWSZ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | 6-chloro-3-methylquinolin-2-amine |
| InChIKey | VHUGVEXJEVUWSZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2)Cl)N=C1N |
Computed by PubChem (NCBI)