CAS 1152536-66-7 is the registry number for 1-[2-(Chloromethyl)phenyl]-1h-pyrazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
1-[2-(chloromethyl)phenyl]pyrazole (CAS 1152536-66-7) is a chemical compound with the molecular formula C10H9ClN2 and a molecular weight of 192.64 g/mol. IUPAC name: 1-[2-(chloromethyl)phenyl]pyrazole. InChIKey: YCNALCGXMSNGPT-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | 1-[2-(chloromethyl)phenyl]pyrazole |
| InChIKey | YCNALCGXMSNGPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCl)N2C=CC=N2 |
Computed by PubChem (NCBI)