Products 1152536-66-7

CAS 1152536-66-7 is the registry number for 1-[2-(Chloromethyl)phenyl]-1h-pyrazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-[2-(chloromethyl)phenyl]pyrazole (CAS 1152536-66-7) is a chemical compound with the molecular formula C10H9ClN2 and a molecular weight of 192.64 g/mol. IUPAC name: 1-[2-(chloromethyl)phenyl]pyrazole. InChIKey: YCNALCGXMSNGPT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9ClN2
Molecular weight192.64 g/mol
IUPAC name1-[2-(chloromethyl)phenyl]pyrazole
InChIKeyYCNALCGXMSNGPT-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CCl)N2C=CC=N2

Computed by PubChem (NCBI)