CAS 7666-52-6 appears in our catalog under these names: 5-Chloro-1-methyl-2-phenyl-1h-imidazole, 95%, 5–Chloro–1–methyl–2–phenyl–1H–imidazole, 5-Chloro-1-methyl-2-phenyl-1H-imidazole, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg.
5-chloro-1-methyl-2-phenylimidazole (CAS 7666-52-6) is a chemical compound with the molecular formula C10H9ClN2 and a molecular weight of 192.64 g/mol. IUPAC name: 5-chloro-1-methyl-2-phenylimidazole. InChIKey: VRRDPPHOZQOYGA-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | 5-chloro-1-methyl-2-phenylimidazole |
| InChIKey | VRRDPPHOZQOYGA-UHFFFAOYSA-N |
| SMILES | CN1C(=CN=C1C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)