cas: 19690-23-4 — see every product listed under this CAS number, including other names
2-Amino-6-iodopurine, >98.0%(HPLC)(T) (CAS 19690-23-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2068-5G |
| cas | 19690-23-4 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 472.39 Pln | |
| TCI | 25g | 1460.75 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
6-iodo-7H-purin-2-amine (CAS 19690-23-4) is a chemical compound with the molecular formula C5H4IN5 and a molecular weight of 261.02 g/mol. IUPAC name: 6-iodo-7H-purin-2-amine. InChIKey: CQYPNVKLVHHOSJ-UHFFFAOYSA-N.
| Molecular formula | C5H4IN5 |
|---|---|
| Molecular weight | 261.02 g/mol |
| IUPAC name | 6-iodo-7H-purin-2-amine |
| InChIKey | CQYPNVKLVHHOSJ-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)N)I |
Computed by PubChem (NCBI)