cas: 19690-23-4 — see every product listed under this CAS number, including other names
6-Iodo-9H-purin-2-amine, 99%(HPLC),RG, 99%(HPLC),RG (CAS 19690-23-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114N9Z-1g |
| cas | 19690-23-4 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 352.40 Pln | |
| Chemat | 25g | 1326.80 Pln | |
| Chemat | 100g | 4619.60 Pln |
| purity | 99%(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
6-iodo-7H-purin-2-amine (CAS 19690-23-4) is a chemical compound with the molecular formula C5H4IN5 and a molecular weight of 261.02 g/mol. IUPAC name: 6-iodo-7H-purin-2-amine. InChIKey: CQYPNVKLVHHOSJ-UHFFFAOYSA-N.
| Molecular formula | C5H4IN5 |
|---|---|
| Molecular weight | 261.02 g/mol |
| IUPAC name | 6-iodo-7H-purin-2-amine |
| InChIKey | CQYPNVKLVHHOSJ-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)N)I |
Computed by PubChem (NCBI)