CAS 19690-23-4 appears in our catalog under these names: 2-Amino-6-iodopurine, 95%, 2-Amino-6-iodopurine, 2–Amino–6–iodopurine, 2-Amino-6-iodopurine, >98.0%(HPLC)(T), 6-Iodo-9H-purin-2-amine, 99%(HPLC),RG, 99%(HPLC),RG. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 5g, 1g, 10g, 50g, 100g, 250g.
6-iodo-7H-purin-2-amine (CAS 19690-23-4) is a chemical compound with the molecular formula C5H4IN5 and a molecular weight of 261.02 g/mol. IUPAC name: 6-iodo-7H-purin-2-amine. InChIKey: CQYPNVKLVHHOSJ-UHFFFAOYSA-N.
| Molecular formula | C5H4IN5 |
|---|---|
| Molecular weight | 261.02 g/mol |
| IUPAC name | 6-iodo-7H-purin-2-amine |
| InChIKey | CQYPNVKLVHHOSJ-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)N)I |
Computed by PubChem (NCBI)