cas: 68746-25-8 — see every product listed under this CAS number, including other names
2-Amino-6-tert-butyl-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid amide, 97% (CAS 68746-25-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F058751-1G |
| cas | 68746-25-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1596.33 Pln | |
| Fluorochem | 5g | 5386.66 Pln | |
| Fluorochem | 10g | 9192.61 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (CAS 68746-25-8) is a chemical compound with the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. IUPAC name: 2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide. InChIKey: LBXIAHFWOUNFCV-UHFFFAOYSA-N.
| Molecular formula | C13H20N2OS |
|---|---|
| Molecular weight | 252.38 g/mol |
| IUPAC name | 2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| InChIKey | LBXIAHFWOUNFCV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2=C(C1)SC(=C2C(=O)N)N |
Computed by PubChem (NCBI)