CAS 749906-98-7 is the registry number for 5-tert-Butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (CAS 749906-98-7) is a chemical compound with the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. IUPAC name: 5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide. InChIKey: ZDLDYLFPNXWQJY-UHFFFAOYSA-N.
| Molecular formula | C13H20N2OS |
|---|---|
| Molecular weight | 252.38 g/mol |
| IUPAC name | 5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| InChIKey | ZDLDYLFPNXWQJY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2=C(C1)C=C(S2)C(=O)NN |
Computed by PubChem (NCBI)