CAS 956576-54-8 appears in our catalog under these names: 6-tert-Butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide, 95%, 6-(tert-Butyl)-4,5,6,7-tetrahydrobenzo(b)thiophene-2-carbohydrazide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (CAS 956576-54-8) is a chemical compound with the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. IUPAC name: 6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide. InChIKey: SXQVIBXIOIDPAU-UHFFFAOYSA-N.
| Molecular formula | C13H20N2OS |
|---|---|
| Molecular weight | 252.38 g/mol |
| IUPAC name | 6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| InChIKey | SXQVIBXIOIDPAU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2=C(C1)SC(=C2)C(=O)NN |
Computed by PubChem (NCBI)