CAS 20061-68-1 is the registry number for 2-Amino-9H-xanthen-9-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-aminoxanthen-9-one (CAS 20061-68-1) is a chemical compound with the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. IUPAC name: 2-aminoxanthen-9-one. InChIKey: JIDPRRVEJMGZKE-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 2-aminoxanthen-9-one |
| InChIKey | JIDPRRVEJMGZKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)