2-Amino-9H-xanthen-9-one, 95%
cas: 20061-68-1 — see every product listed under this CAS number, including other names
2-Amino-9H-xanthen-9-one, 95% (CAS 20061-68-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1138055-100mg |
| cas | 20061-68-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 693.00 Pln | |
| Ambeed | 250mg | 1121.31 Pln | |
| Ambeed | 1g | 2901.31 Pln | |
| Chemat | 100mg | 693.20 Pln | |
| Chemat | 250mg | 1130.00 Pln | |
| Chemat | 1g | 2944.40 Pln | |
| BLDpharm | 100mg | 680.90 Pln | |
| BLDpharm | 250mg | 1102.97 Pln | |
| BLDpharm | 1g | 2846.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-aminoxanthen-9-one (CAS 20061-68-1) is a chemical compound with the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. IUPAC name: 2-aminoxanthen-9-one. InChIKey: JIDPRRVEJMGZKE-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 2-aminoxanthen-9-one |
| InChIKey | JIDPRRVEJMGZKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)