CAS 1183032-44-1 appears in our catalog under these names: 4-(3-Hydroxyphenoxy)benzonitrile, 98%, 4-(3-Hydroxyphenoxy)benzonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
4-(3-hydroxyphenoxy)benzonitrile (CAS 1183032-44-1) is a chemical compound with the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. IUPAC name: 4-(3-hydroxyphenoxy)benzonitrile. InChIKey: BREVHDCJXJZBCB-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 4-(3-hydroxyphenoxy)benzonitrile |
| InChIKey | BREVHDCJXJZBCB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)C#N)O |
Computed by PubChem (NCBI)