CAS 101855-18-9 is the registry number for 2-Methyl-4H-naphtho[1,2-d][1,3]oxazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylbenzo[h][3,1]benzoxazin-4-one (CAS 101855-18-9) is a chemical compound with the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. IUPAC name: 2-methylbenzo[h][3,1]benzoxazin-4-one. InChIKey: BLQMGWCQDAJNGK-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 2-methylbenzo[h][3,1]benzoxazin-4-one |
| InChIKey | BLQMGWCQDAJNGK-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC3=CC=CC=C32)C(=O)O1 |
Computed by PubChem (NCBI)