2-Amino-N-(2-fluorophenyl)benzamide, 95%
cas: 39511-95-0 — see every product listed under this CAS number, including other names
2-Amino-N-(2-fluorophenyl)benzamide, 95% (CAS 39511-95-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1598320-250mg |
| cas | 39511-95-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 782.00 Pln | |
| Ambeed | 1g | 1927.88 Pln | |
| Chemat | 100mg | 467.60 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1922.00 Pln | |
| BLDpharm | 100mg | 503.18 Pln | |
| BLDpharm | 250mg | 841.95 Pln | |
| BLDpharm | 1g | 2074.85 Pln | |
| Fluorochem | 100mg | 851.80 Pln | |
| Fluorochem | 250mg | 1393.28 Pln | |
| Fluorochem | 1g | 3548.77 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-amino-N-(2-fluorophenyl)benzamide (CAS 39511-95-0) is a chemical compound with the molecular formula C13H11FN2O and a molecular weight of 230.24 g/mol. IUPAC name: 2-amino-N-(2-fluorophenyl)benzamide. InChIKey: RNOQBUILIAQHOT-UHFFFAOYSA-N.
| Molecular formula | C13H11FN2O |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | 2-amino-N-(2-fluorophenyl)benzamide |
| InChIKey | RNOQBUILIAQHOT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=CC=C2F)N |
Computed by PubChem (NCBI)