CAS 66938-86-1 appears in our catalog under these names: (3,4-Diaminophenyl)(4-fluorophenyl)methanone, 95%, (3,4–DIAMINOPHENYL)(4–FLUORO PHENYL)METHANONE, (3,4-Diaminophenyl)(4-fluorophenyl)methanone 97%, (3,4-DIAMINOPHENYL)(4-FLUORO PHENYL)METHANONE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 200mg, 100mg.
(3,4-diaminophenyl)-(4-fluorophenyl)methanone (CAS 66938-86-1) is a chemical compound with the molecular formula C13H11FN2O and a molecular weight of 230.24 g/mol. IUPAC name: (3,4-diaminophenyl)-(4-fluorophenyl)methanone. InChIKey: KHMJNCNXARCUGR-UHFFFAOYSA-N.
| Molecular formula | C13H11FN2O |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | (3,4-diaminophenyl)-(4-fluorophenyl)methanone |
| InChIKey | KHMJNCNXARCUGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC(=C(C=C2)N)N)F |
Computed by PubChem (NCBI)