CAS 251446-40-9 is the registry number for 3-Amino-n-(3-fluorophenyl)benzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-amino-N-(3-fluorophenyl)benzamide (CAS 251446-40-9) is a chemical compound with the molecular formula C13H11FN2O and a molecular weight of 230.24 g/mol. IUPAC name: 3-amino-N-(3-fluorophenyl)benzamide. InChIKey: NTRUKPPSBDQENE-UHFFFAOYSA-N.
| Molecular formula | C13H11FN2O |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | 3-amino-N-(3-fluorophenyl)benzamide |
| InChIKey | NTRUKPPSBDQENE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(=O)NC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)