2-Amino-N-(3-fluorophenyl)benzamide, 95%
cas: 219492-66-7 — see every product listed under this CAS number, including other names
2-Amino-N-(3-fluorophenyl)benzamide, 95% (CAS 219492-66-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1087493-100mg |
| cas | 219492-66-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 559.50 Pln | |
| Ambeed | 1g | 1371.62 Pln | |
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 1259.60 Pln | |
| Fluorochem | 100mg | 586.27 Pln | |
| Fluorochem | 250mg | 924.69 Pln | |
| Fluorochem | 1g | 2335.65 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 547.61 Pln | |
| BLDpharm | 1g | 1347.33 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-amino-N-(3-fluorophenyl)benzamide (CAS 219492-66-7) is a chemical compound with the molecular formula C13H11FN2O and a molecular weight of 230.24 g/mol. IUPAC name: 2-amino-N-(3-fluorophenyl)benzamide. InChIKey: UUNGQEZMZQDIKE-UHFFFAOYSA-N.
| Molecular formula | C13H11FN2O |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | 2-amino-N-(3-fluorophenyl)benzamide |
| InChIKey | UUNGQEZMZQDIKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC(=CC=C2)F)N |
Computed by PubChem (NCBI)