cas: 32212-38-7 — see every product listed under this CAS number, including other names
2-Amino-N-(p-tolyl)benzamide, 98% (CAS 32212-38-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F324109-100MG |
| cas | 32212-38-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 690.40 Pln | |
| Fluorochem | 25g | 1950.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-N-(4-methylphenyl)benzamide (CAS 32212-38-7) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: 2-amino-N-(4-methylphenyl)benzamide. InChIKey: ULNAKLMMGXHGJQ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2-amino-N-(4-methylphenyl)benzamide |
| InChIKey | ULNAKLMMGXHGJQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)C2=CC=CC=C2N |
Computed by PubChem (NCBI)