CAS 138039-48-2 appears in our catalog under these names: (1R,2S)-2-Aminocyclopent-3-enecarboxylic acid, 97%, 2-Aminocyclopent-3-ene-COOH (R,S/S,R). Offered by: Chemat Brand, Iris Biotech. Available pack sizes: on request, 1g.
(1R,2S)-2-aminocyclopent-3-ene-1-carboxylic acid (CAS 138039-48-2) is a chemical compound with the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. IUPAC name: (1R,2S)-2-aminocyclopent-3-ene-1-carboxylic acid. InChIKey: NLCBWTXCWRLPIR-UHNVWZDZSA-N.
| Molecular formula | C6H9NO2 |
|---|---|
| Molecular weight | 127.14 g/mol |
| IUPAC name | (1R,2S)-2-aminocyclopent-3-ene-1-carboxylic acid |
| InChIKey | NLCBWTXCWRLPIR-UHNVWZDZSA-N |
| SMILES | C1C=C[C@@H]([C@@H]1C(=O)O)N |
Computed by PubChem (NCBI)