cas: 946-33-8 — see every product listed under this CAS number, including other names
2-Benzylcyclohexanone, 95%, 95% (CAS 946-33-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GL4-250mg |
| cas | 946-33-8 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 933.20 Pln | |
| Chemat | 10g | 1629.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-benzylcyclohexan-1-one (CAS 946-33-8) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: 2-benzylcyclohexan-1-one. InChIKey: CUYLPYBYCYQGCE-UHFFFAOYSA-N.
| Molecular formula | C13H16O |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | 2-benzylcyclohexan-1-one |
| InChIKey | CUYLPYBYCYQGCE-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C(C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)