CAS 266351-90-0 is the registry number for 1-Methoxy-4-((1e,3e)-2-methylpenta-1,3-dien-1-yl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-methoxy-4-[(1E,3E)-2-methylpenta-1,3-dienyl]benzene (CAS 266351-90-0) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: 1-methoxy-4-[(1E,3E)-2-methylpenta-1,3-dienyl]benzene. InChIKey: VZWIJSKUHMHFMT-PMXBNEBOSA-N.
| Molecular formula | C13H16O |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | 1-methoxy-4-[(1E,3E)-2-methylpenta-1,3-dienyl]benzene |
| InChIKey | VZWIJSKUHMHFMT-PMXBNEBOSA-N |
| SMILES | C/C=C/C(=C/C1=CC=C(C=C1)OC)/C |
Computed by PubChem (NCBI)