CAS 162752-17-2 appears in our catalog under these names: 6-tert-Butyl-1-indanone, 98%, 6-tert-Butyl-1-indanone, 6-(tert-Butyl)-2,3-dihydro-1H-inden-1-one, 97%, 97%, 6-(tert-Butyl)-2,3-dihydro-1H-inden-1-one, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g.
6-tert-butyl-2,3-dihydroinden-1-one (CAS 162752-17-2) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: 6-tert-butyl-2,3-dihydroinden-1-one. InChIKey: VICFYSNYODVXCU-UHFFFAOYSA-N.
| Molecular formula | C13H16O |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | 6-tert-butyl-2,3-dihydroinden-1-one |
| InChIKey | VICFYSNYODVXCU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(CCC2=O)C=C1 |
Computed by PubChem (NCBI)