CAS 1154917-07-3 appears in our catalog under these names: 8-Ethyl-2-(propan-2-yl)-1,4-dihydroquinolin-4-one, 95%, 8-Ethyl-2-(propan-2-yl)-1,4-dihydroquinolin-4-one, 98%, 8-Ethyl-2-(propan-2-yl)-1,4-dihydroquinolin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
8-ethyl-2-propan-2-yl-1H-quinolin-4-one (CAS 1154917-07-3) is a chemical compound with the molecular formula C14H17NO and a molecular weight of 215.29 g/mol. IUPAC name: 8-ethyl-2-propan-2-yl-1H-quinolin-4-one. InChIKey: ULVLYUARSSIFRN-UHFFFAOYSA-N.
| Molecular formula | C14H17NO |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | 8-ethyl-2-propan-2-yl-1H-quinolin-4-one |
| InChIKey | ULVLYUARSSIFRN-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C(=O)C=C(N2)C(C)C |
Computed by PubChem (NCBI)