Products 938458-76-5
CAS 938458-76-5 is the registry number for 1-(2,3-Dihydro-1h-inden-5-yl)piperidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-one (CAS 938458-76-5) is a chemical compound with the molecular formula C14H17NO and a molecular weight of 215.29 g/mol. IUPAC name: 1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-one. InChIKey: TXXRZOKECZXFAB-UHFFFAOYSA-N.
| Molecular formula | C14H17NO |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | 1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-one |
| InChIKey | TXXRZOKECZXFAB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)N3CCC(=O)CC3 |
Computed by PubChem (NCBI)